Submitters:
Notes on implementation:
In this assignment, we will implement the sum-product and max-sum algorithms for factor graphs over discrete variables. The relevant theory is covered in chapter 8 of Bishop's PRML book, in particular section 8.4. Read this chapter carefuly before continuing!
We will first implement sum-product and max-sum and apply it to a simple poly-tree structured factor graph for medical diagnosis. Then, we will implement a loopy version of the algorithms and use it for image denoising.
For this assignment we recommended you stick to numpy ndarrays (constructed with np.array, np.zeros, np.ones, etc.) as opposed to numpy matrices, because arrays can store n-dimensional arrays whereas matrices only work for 2d arrays. We need n-dimensional arrays in order to store conditional distributions with more than 1 conditioning variable. If you want to perform matrix multiplication on arrays, use the np.dot function; all infix operators including *, +, -, work element-wise on arrays.
We will implement a datastructure to store a factor graph and to facilitate computations on this graph. Recall that a factor graph consists of two types of nodes, factors and variables. Below you will find some classes for these node types to get you started. Carefully inspect this code and make sure you understand what it does; you will have to build on it later.
In [95]:
%pylab inline
np.set_printoptions(precision=4)
class Node(object):
"""
Base-class for Nodes in a factor graph. Only instantiate sub-classes of Node.
"""
def __init__(self, name):
# A name for this Node, for printing purposes
self.name = name
# Neighbours in the graph, identified with their index in this list.
# i.e. self.neighbours contains neighbour 0 through len(self.neighbours) - 1.
self.neighbours = []
# Reset the node-state (not the graph topology)
self.reset()
def reset(self):
# Incoming messages; a dictionary mapping neighbours to messages.
# That is, it maps Node -> np.ndarray.
self.in_msgs = {}
# A set of neighbours for which this node has pending messages.
# We use a python set object so we don't have to worry about duplicates.
self.pending = set([])
def add_neighbour(self, nb):
self.neighbours.append(nb)
def send_sp_msg(self, other):
# To be implemented in subclass.
raise Exception('Method send_sp_msg not implemented in base-class Node')
def send_ms_msg(self, other):
# To be implemented in subclass.
raise Exception('Method send_ms_msg not implemented in base-class Node')
def receive_msg(self, other, msg):
# Store the incomming message, replacing previous messages from the same node
self.in_msgs[other] = msg
# TODO: add pending messages
# self.pending.update(...)
def __str__(self):
# This is printed when using 'print node_instance'
return self.name
class Variable(Node):
def __init__(self, name, num_states):
"""
Variable node constructor.
Args:
name: a name string for this node. Used for printing.
num_states: the number of states this variable can take.
Allowable states run from 0 through (num_states - 1).
For example, for a binary variable num_states=2,
and the allowable states are 0, 1.
"""
self.num_states = num_states
# Call the base-class constructor
super(Variable, self).__init__(name)
def set_observed(self, observed_state):
"""
Set this variable to an observed state.
Args:
observed_state: an integer value in [0, self.num_states - 1].
"""
# Observed state is represented as a 1-of-N variable
# Could be 0.0 for sum-product, but log(0.0) = -inf so a tiny value is preferable for max-sum
self.observed_state[:] = 0.000001
self.observed_state[observed_state] = 1.0
def set_latent(self):
"""
Erase an observed state for this variable and consider it latent again.
"""
# No state is preferred, so set all entries of observed_state to 1.0
# Using this representation we need not differentiate between observed and latent
# variables when sending messages.
self.observed_state[:] = 1.0
def reset(self):
super(Variable, self).reset()
self.observed_state = np.ones(self.num_states)
def marginal(self, Z=None):
"""
Compute the marginal distribution of this Variable.
It is assumed that message passing has completed when this function is called.
Args:
Z: an optional normalization constant can be passed in. If None is passed, Z is computed.
Returns: marginal, Z. The first is a numpy array containing the normalized marginal distribution.
Z is either equal to the input Z, or computed in this function (if Z=None was passed).
"""
# TODO: compute marginal
return None, Z
def send_sp_msg(self, other):
# TODO: implement Variable -> Factor message for sum-product
pass
def send_ms_msg(self, other):
# TODO: implement Variable -> Factor message for max-sum
pass
class Factor(Node):
def __init__(self, name, f, neighbours):
"""
Factor node constructor.
Args:
name: a name string for this node. Used for printing
f: a numpy.ndarray with N axes, where N is the number of neighbours.
That is, the axes of f correspond to variables, and the index along that axes corresponds to a value of that variable.
Each axis of the array should have as many entries as the corresponding neighbour variable has states.
neighbours: a list of neighbouring Variables. Bi-directional connections are created.
"""
# Call the base-class constructor
super(Factor, self).__init__(name)
assert len(neighbours) == f.ndim, 'Factor function f should accept as many arguments as this Factor node has neighbours'
for nb_ind in range(len(neighbours)):
nb = neighbours[nb_ind]
assert f.shape[nb_ind] == nb.num_states, 'The range of the factor function f is invalid for input %i %s' % (nb_ind, nb.name)
self.add_neighbour(nb)
nb.add_neighbour(self)
self.f = f
def send_sp_msg(self, other):
# TODO: implement Factor -> Variable message for sum-product
pass
def send_ms_msg(self, other):
# TODO: implement Factor -> Variable message for max-sum
pass
In [96]:
# returns all the messages from neighbours except the other
def get_neighbour_messages(self,other):
mes = []
for ne in self.neighbours:
if ne==other: continue
if ne not in self.in_msgs: raise Exception('Some messages are not still received')
mes.append(self.in_msgs[ne])
return mes
Node.get_neighbour_messages = get_neighbour_messages
In [97]:
# a procedure that sends messages
def send_msg_proc(self, other, mes):
# print "mes "+self.name+"-->"+str(other.name)+" : "+ str(mes)
other.receive_msg(self,mes)
self.pending.remove(other)
Node.send_msg_proc = send_msg_proc
Convert the directed graphical model ("Bayesian Network") shown below to a factor graph. Instantiate this graph by creating Variable and Factor instances and linking them according to the graph structure. To instantiate the factor graph, first create the Variable nodes and then create Factor nodes, passing a list of neighbour Variables to each Factor. Use the following prior and conditional probabilities.
$$ p(\verb+Influenza+) = 0.05 \\\\ p(\verb+Smokes+) = 0.2 \\\\ $$$$ p(\verb+SoreThroat+ = 1 | \verb+Influenza+ = 1) = 0.3 \\\\ p(\verb+SoreThroat+ = 1 | \verb+Influenza+ = 0) = 0.001 \\\\ p(\verb+Fever+ = 1| \verb+Influenza+ = 1) = 0.9 \\\\ p(\verb+Fever+ = 1| \verb+Influenza+ = 0) = 0.05 \\\\ p(\verb+Bronchitis+ = 1 | \verb+Influenza+ = 1, \verb+Smokes+ = 1) = 0.99 \\\\ p(\verb+Bronchitis+ = 1 | \verb+Influenza+ = 1, \verb+Smokes+ = 0) = 0.9 \\\\ p(\verb+Bronchitis+ = 1 | \verb+Influenza+ = 0, \verb+Smokes+ = 1) = 0.7 \\\\ p(\verb+Bronchitis+ = 1 | \verb+Influenza+ = 0, \verb+Smokes+ = 0) = 0.0001 \\\\ p(\verb+Coughing+ = 1| \verb+Bronchitis+ = 1) = 0.8 \\\\ p(\verb+Coughing+ = 1| \verb+Bronchitis+ = 0) = 0.07 \\\\ p(\verb+Wheezing+ = 1| \verb+Bronchitis+ = 1) = 0.6 \\\\ p(\verb+Wheezing+ = 1| \verb+Bronchitis+ = 0) = 0.001 \\\\ $$
In [98]:
from IPython.core.display import Image
Image(filename='bn.png')
Out[98]:
We have transformed the bayesian network to a factor graph as following:
where:
$$ f_1 = p(ST|I)\\\\ f_2 = p(F|I)\\\\ f_3 = p(B|I,S)\\\\ f_4 = p(C|B)\\\\ f_5 = p(W|B)\\\\ f_6 = p(S)\\\\ f_7 = p(I) $$
In [99]:
# Variables
def init_variables():
I = Variable('Influenza', 2)
S = Variable('Smokes', 2)
ST = Variable('SoreThroat', 2)
F = Variable('Fever', 2)
B = Variable('Bronchitits', 2)
C = Variable('Coughing', 2)
W = Variable('Wheezing', 2)
return I, S, ST, F, B, C, W
In [100]:
# Factor nodes
def init_f1(I, ST):
# Order: I, ST
f1_weights = np.empty((2, 2))
f1_weights[1, 1] = 0.3
f1_weights[0, 1] = 0.001
f1_weights[:, 0] = 1 - f1_weights[:, 1]
f1 = Factor('f1', f1_weights, [I, ST])
return f1
In [101]:
def init_f2(I, F):
# Order: I, F
f2_weights = np.empty((2, 2))
f2_weights[1, 1] = 0.9
f2_weights[0, 1] = 0.05
f2_weights[:, 0] = 1 - f2_weights[:, 1]
f2 = Factor('f2', f2_weights, [I, F])
return f2
In [102]:
def init_f3(I, S, B):
# Order: I, S, B
f3_weights = np.empty((2, 2, 2))
f3_weights[1, 1, 1] = 0.99
f3_weights[1, 0, 1] = 0.9
f3_weights[0, 1, 1] = 0.7
f3_weights[0, 0, 1] = 0.0001
f3_weights[:, :, 0] = 1 - f3_weights[:, :, 1]
f3 = Factor('f3', f3_weights, [I, S, B])
return f3
In [103]:
def init_f4(B, C):
# Order: B, C
f4_weights = np.empty((2, 2))
f4_weights[1, 1] = 0.8
f4_weights[0, 1] = 0.07
f4_weights[:, 0] = 1 - f4_weights[:, 1]
f4 = Factor('f4', f4_weights, [B, C])
return f4
In [104]:
def init_f5(B, W):
# Order: B, W
f5_weights = np.empty((2, 2))
f5_weights[1, 1] = 0.6
f5_weights[0, 1] = 0.001
f5_weights[:, 0] = 1 - f5_weights[:, 1]
f5 = Factor('f5', f5_weights, [B, W])
return f5
In [105]:
def init_f6(S):
f6_weights = np.array([0.8, 0.2])
f6 = Factor('f6', f6_weights, [S])
return f6
In [106]:
def init_f7(I):
f7_weights = np.array([0.95, 0.05])
f7 = Factor('f7', f7_weights, [I])
return f7
Write a method send_sp_msg(self, other)
for the Factor class, that checks if all the information required to pass a message to Variable other
is present, computes the message and sends it to other
. "Sending" here simply means calling the receive_msg
function of the receiving node (we will implement this later). The message itself should be represented as a numpy array (np.array) whose length is equal to the number of states of the variable.
An elegant and efficient solution can be obtained using the n-way outer product of vectors. This product takes n vectors $\mathbf{x}^{(1)}, \ldots, \mathbf{x}^{(n)}$ and computes a $n$-dimensional tensor (ndarray) whose element $i_0,i_1,...,i_n$ is given by $\prod_j \mathbf{x}^{(j)}_{i_j}$. In python, this is realized as np.multiply.reduce(np.ix_(*vectors))
for a python list vectors
of 1D numpy arrays. Try to figure out how this statement works -- it contains some useful functional programming techniques. Another function that you may find useful in computing the message is np.tensordot
.
In [107]:
def factor_send_sp_msg(self, other):
assert isinstance(other,Variable)
if other not in self.neighbours:
raise Exception('The specified node is not a neighbour')
factor_indexes = range(len(self.neighbours))
factor_indexes.remove(self.neighbours.index(other))
message_indexes = range(len(factor_indexes))
# computing messages
mes = self.get_neighbour_messages(other)
mes = np.tensordot(self.f,np.multiply.reduce(np.ix_(*mes)),axes=(factor_indexes,message_indexes))
# sending the message
self.send_msg_proc(other,mes)
Factor.send_sp_msg=factor_send_sp_msg
In [108]:
def variable_send_sp_msg(self, other):
assert isinstance(other, Factor)
# checking if the target factor node has the current node in its neighbours
assert self in other.neighbours
# computing the message
mes = np.prod(self.get_neighbour_messages(other),axis=0) * self.observed_state
self.send_msg_proc(other,mes)
Variable.send_sp_msg = variable_send_sp_msg
Later in this assignment, we will implement message passing schemes to do inference. Once the message passing has completed, we will want to compute local marginals for each variable.
Write the method marginal
for the Variable class, that computes a marginal distribution over that node.
In [109]:
def variable_marginal(self, Z=None):
"""
Compute the marginal distribution of this Variable.
It is assumed that message passing has completed when this function is called.
Args:
Z: an optional normalization constant can be passed in. If None is passed, Z is computed.
Returns: marginal, Z. The first is a numpy array containing the normalized marginal distribution.
Z is either equal to the input Z, or computed in this function (if Z=None was passed).
"""
mar = np.prod(self.in_msgs.values(),axis=0) * self.observed_state
if Z==None:Z=sum(mar)
return mar/Z, Z
Variable.marginal = variable_marginal
In order to implement the loopy and non-loopy message passing algorithms, we need some way to determine which nodes are ready to send messages to which neighbours. To do this in a way that works for both loopy and non-loopy algorithms, we make use of the concept of "pending messages", which is explained in Bishop (8.4.7): "we will say that a (variable or factor) node a has a message pending on its link to a node b if node a has received any message on any of its other links since the last time it send (sic) a message to b. Thus, when a node receives a message on one of its links, this creates pending messages on all of its other links."
Keep in mind that for the non-loopy algorithm, nodes may not have received any messages on some or all of their links. Therefore, before we say node a has a pending message for node b, we must check that node a has received all messages needed to compute the message that is to be sent to b.
Modify the function receive_msg
, so that it updates the self.pending variable as described above. The member self.pending is a set that is to be filled with Nodes to which self has pending messages. Modify the send_msg
functions to remove pending messages as they are sent.
In [110]:
def node_receive_msg(self, other, msg):
# Store the incoming message, replacing previous messages from the same node
self.in_msgs[other] = msg
# print '%s receives message from %s: %s' % (self, other, msg)
for neighbour in set(self.neighbours) - {other}:
if neighbour in self.in_msgs:
# If received all messages from neighbours
if len(self.in_msgs) == len(self.neighbours):
self.pending.update([neighbour])
elif len(self.in_msgs) == len(self.neighbours) - 1:
# If all incoming messages received
self.pending.update([neighbour])
Node.receive_msg = node_receive_msg
Write a function sum_product(node_list)
that runs the sum-product message passing algorithm on a tree-structured factor graph with given nodes. The input parameter node_list
is a list of all Node instances in the graph, which is assumed to be ordered correctly. That is, the list starts with a leaf node, which can always send a message. Subsequent nodes in node_list
should be capable of sending a message when the pending messages of preceding nodes in the list have been sent. The sum-product algorithm then proceeds by passing over the list from beginning to end, sending all pending messages at the nodes it encounters. Then, in reverse order, the algorithm traverses the list again and again sends all pending messages at each node as it is encountered. For this to work, you must initialize pending messages for all the leaf nodes, e.g. influenza_prior.pending.add(influenza)
, where influenza_prior
is a Factor node corresponding the the prior, influenza
is a Variable node and the only connection of influenza_prior
goes to influenza
.
In [111]:
def apply_algorithm(node_list, func):
for node in node_list:
for other in list(node.pending):
func(node, other)
def sum_product(node, other):
node.send_sp_msg(other)
In [112]:
def configure_experiment():
variables = init_variables()
I, S, ST, F, B, C, W = variables
f1 = init_f1(I, ST)
f2 = init_f2(I, F)
f3 = init_f3(I, S, B)
f4 = init_f4(B, C)
f5 = init_f5(B, W)
f6 = init_f6(S)
f7 = init_f7(I)
f6.pending.update([S])
f7.pending.update([I])
ST.pending.update([f1])
F.pending.update([f2])
C.pending.update([f4])
W.pending.update([f5])
return (I, S, ST, F, B, C, W), (f1, f2, f3, f4, f5, f6, f7)
In [113]:
def print_marginals(variables):
for variable in variables:
marginal, Z = variable.marginal(None)
print variable, marginal
In [114]:
variables, factors = configure_experiment()
I, S, ST, F, B, C, W = variables
f1, f2, f3, f4, f5, f6, f7 = factors
node_list = [f6, f7, W, C, F, f4, f5, S, f2, B, f3, I, f1, ST]
print '-----Forward pass-----'
apply_algorithm(node_list, sum_product)
ST.pending.update([f1])
print '-----Backward pass-----'
apply_algorithm(reversed(node_list), sum_product)
print '-----Marginals-----'
print_marginals(variables)
We will now use the inference engine to answer probabilistic queries. That is, we will set certain variables to observed values, and obtain the marginals over latent variables. We have already provided functions set_observed
and set_latent
that manage a member of Variable called observed_state
. Modify the Variable.send_msg
and Variable.marginal
routines that you wrote before, to use observed_state
so as to get the required marginals when some nodes are observed.
In [115]:
variables, factors = configure_experiment()
I, S, ST, F, B, C, W = variables
f1, f2, f3, f4, f5, f6, f7 = factors
B.set_observed(1)
node_list = [f6, f7, W, C, F, f4, f5, S, f2, B, f3, I, f1, ST]
print 'Forward pass'
apply_algorithm(node_list, sum_product)
ST.pending.update([f1])
print 'Backward pass'
apply_algorithm(reversed(node_list), sum_product)
print_marginals(variables)
A maximum a posteriori state (MAP-state) is an assignment of all latent variables that maximizes the probability of latent variables given observed variables: $$ \mathbf{x}_{\verb+MAP+} = \arg\max _{\mathbf{x}} p(\mathbf{x} | \mathbf{y}) $$ Could we use the sum-product algorithm to obtain a MAP state? If yes, how? If no, why not?
Answer: It's possible to compute MAP by factorizing $p(x|y)$ into components and considering all possible combinations of its components, for example:
$$ p(x|y) = p(x_1)p(y_1|x_1)p(x_3|x_1)p(x_2|y_1) $$in the case of a bayesian network $y_1 \rightarrow x_2$, $x_1 \rightarrow x_3$, $y_1 \rightarrow x_1$, and $y_1$ is observed. By considering all possibilites of states $p(x_1)$, $p(y_1|x_1)$, etc and computing them using sum-product algorithm, we can compute MAP but it's not efficient, that's why we need max-sum.
Technically, we could compute conditional probabilities using sum-product by using set_observed() methods, which we used in the previous task. The main inefficiency is caused by the fact that we will be forced to recompute messages once the combination of initially observed states changes.
In [116]:
def factor_send_ms_msg(self, other):
assert isinstance(other,Variable)
if not other in self.neighbours:
raise Exception('The specified node is not a neighbour')
factor_indexes = range(len(self.neighbours))
factor_indexes.remove(self.neighbours.index(other))
mes = self.get_neighbour_messages(other)
# computing messages
mes = np.expand_dims(np.add.reduce(np.ix_(*mes)), self.neighbours.index(other))
mes = np.apply_over_axes(np.amax, np.log(self.f)+mes,factor_indexes).squeeze()
# sending the message
self.send_msg_proc(other,mes)
Factor.send_ms_msg = factor_send_ms_msg
In [117]:
def variable_send_ms_msg(self, other):
assert isinstance(other, Factor)
# checking if the target factor node has the current node in its neighbours
assert self in other.neighbours
# computing the message
mes = np.sum(self.get_neighbour_messages(other),axis=0)+np.log(self.observed_state)
self.send_msg_proc(other, mes)
Variable.send_ms_msg = variable_send_ms_msg
Using the same message passing schedule we used for sum-product, implement the max-sum algorithm. For simplicity, we will ignore issues relating to non-unique maxima. So there is no need to implement backtracking; the MAP state is obtained by a per-node maximization (eq. 8.98 in Bishop). Make sure your algorithm works with both latent and observed variables.
In [118]:
def map_state(self):
# Returns 0 state or 1
return np.argmax(np.add.reduce(self.in_msgs.values()) + np.log(self.observed_state))
Variable.map_state = map_state
In [119]:
def max_sum(node, other):
node.send_ms_msg(other)
In [120]:
def print_map_states(variables):
for variable in variables:
map_state = variable.map_state()
print variable, map_state
In [121]:
variables, factors = configure_experiment()
I, S, ST, F, B, C, W = variables
f1, f2, f3, f4, f5, f6, f7 = factors
B.set_observed(1)
node_list = [f6, f7, W, C, F, f4, f5, S, f2, B, f3, I, f1, ST]
print 'Forward pass'
apply_algorithm(node_list, max_sum)
ST.pending.update([f1])
print 'Backward pass'
apply_algorithm(reversed(node_list), max_sum)
print_map_states(variables)
Next, we will use a loopy version of max-sum to perform denoising on a binary image. The model itself is discussed in Bishop 8.3.3, but we will use loopy max-sum instead of Iterative Conditional Modes as Bishop does.
The following code creates some toy data. im
is a quite large binary image, test_im
is a smaller synthetic binary image. Noisy versions are also provided.
In [122]:
from pylab import imread, gray
# Load the image and binarize
im = np.mean(imread('dalmatian1.png'), axis=2) > 0.5
imshow(im)
gray()
# Add some noise
noise = np.random.rand(*im.shape) > 0.9
noise_im = np.logical_xor(noise, im)
figure()
imshow(noise_im)
test_im = np.zeros((10,10))
#test_im[5:8, 3:8] = 1.0
#test_im[5,5] = 1.0
figure()
imshow(test_im)
# Add some noise
noise = np.random.rand(*test_im.shape) > 0.9
noise_test_im = np.logical_xor(noise, test_im)
figure()
imshow(noise_test_im)
show()
In [123]:
def create_factor_graph(img):
from itertools import product
Y = np.empty(img.shape, dtype='object')
X = np.empty(img.shape, dtype='object')
fYX = np.empty(img.shape, dtype='object')
fXR = np.empty((img.shape[0] - 1, img.shape[1] - 1), dtype='object')
fXB = np.empty((img.shape[0] - 1, img.shape[1] - 1), dtype='object')
init_prob = np.array([[0.8, 0.2], [0.2, 0.8]])
for y, x in product(range(img.shape[0]), range(img.shape[1])):
Y[y, x] = Variable('y(%d,%d)' % (x, y), 2)
Y[y, x].set_observed(img[y, x])
X[y, x] = Variable('x(%d,%d)' % (x, y), 2)
fYX[y, x] = Factor('fXY(%d,%d)' % (x, y), init_prob, [Y[y, x], X[y, x]])
Y[y, x].pending.update([fYX[y, x]])
one_msg = np.ones(2)
for y, x in product(range(img.shape[0] - 1), range(img.shape[1] - 1)):
fXR[y, x] = Factor('fXR(%d,%d)' % (x, y), init_prob, [X[y, x], X[y, x + 1]])
fXB[y, x] = Factor('fXB(%d,%d)' % (x, y), init_prob, [X[y, x], X[y + 1, x]])
# Flooding schedule, simultaneously passing a message across every link in both direction
# Bishop 8.4.7
X[y, x].in_msgs[fXR[y, x]] = one_msg
X[y, x].in_msgs[fXB[y, x]] = one_msg
X[y, x + 1].in_msgs[fXR[y, x]] = one_msg
X[y + 1, x].in_msgs[fXB[y, x]] = one_msg
return Y, X, fYX, fXR, fXB
In [124]:
def denoise(img, niter=10):
from itertools import product
Y, X, fYX, fXR, fXB = create_factor_graph(img)
for i in range(niter):
fXX = np.hstack((fXR.flatten(), fXB.flatten()))
np.random.shuffle(fXX)
# Preordered, first observed variables, then factors between observed variables and
# corresponding laten variables, then all latent variables and then factors between
# latents in the random order.
node_list = np.hstack((Y.flatten(), fYX.flatten(), X.flatten(), fXX)).tolist()
apply_algorithm(node_list, max_sum)
result = np.zeros_like(img)
for y, x in product(range(img.shape[0]), range(img.shape[1])):
result[y, x] = X[y, x].map_state()
return result
In [125]:
imshow(denoise(noise_test_im))
show()
In [59]:
imshow(denoise(noise_im, niter=10))
show()
In [ ]: